
CAS 112289-20-0
:Kojipentaose
Description:
Kojipentaose is a type of oligosaccharide, specifically a non-reducing disaccharide derived from the enzymatic breakdown of starch or other polysaccharides. It is composed of multiple glucose units linked together, typically through α-(1→6) glycosidic bonds, which contribute to its structural properties. Kojipentaose is known for its potential prebiotic effects, promoting the growth of beneficial gut bacteria. It is soluble in water and exhibits low sweetness compared to common sugars, making it suitable for various food applications, particularly in functional foods and dietary supplements. Additionally, it may possess antioxidant properties and has been studied for its potential health benefits, including enhancing gut health and immune function. Due to its unique structure and properties, kojipentaose is of interest in both food science and nutrition research. Its CAS number, 112289-20-0, is used for identification in chemical databases and regulatory contexts.
Formula:C30H52O26
InChI:InChI=1S/C30H52O26/c31-1-6-12(37)17(42)22(26(47)48-6)53-28-24(19(44)14(39)8(3-33)50-28)55-30-25(20(45)15(40)10(5-35)52-30)56-29-23(18(43)13(38)9(4-34)51-29)54-27-21(46)16(41)11(36)7(2-32)49-27/h6-47H,1-5H2/t6?,7?,8?,9?,10?,11-,12-,13-,14-,15-,16+,17+,18+,19+,20+,21?,22?,23?,24?,25?,26+,27-,28-,29-,30-/m1/s1
InChI key:LPUCVGTXBQBBNA-CXYKPIAASA-N
SMILES:C(C1[C@H]([C@@H](C([C@H](O1)O)O[C@@H]2C([C@H]([C@@H](C(O2)CO)O)O)O[C@@H]3C([C@H]([C@@H](C(O3)CO)O)O)O[C@@H]4C([C@H]([C@@H](C(O4)CO)O)O)O[C@@H]5C([C@H]([C@@H](C(O5)CO)O)O)O)O)O)O
Synonyms:- Kojipentaose
- D-Glucose, O-α-D-glucopyranosyl-(1→2)-O-α-D-glucopyranosyl-(1→2)-O-α-D-glucopyranosyl-(1→2)-O-α-D-glucopyranosyl-(1→2)-
- O-alpha-D-Glucopyranosyl-(1-2)-O-alpha-D-glucopyranosyl-(1-2)-O-alpha-D-glucopyranosyl-(1-2)-O-alpha-D-glucopyranosyl-(1-2)-D-glucose
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery