CAS 1123-09-7
:3,5-Dimethyl-2-cyclohexen-1-one
Description:
3,5-Dimethyl-2-cyclohexen-1-one, with the CAS number 1123-09-7, is an organic compound characterized by its cyclic structure and unsaturation. It features a cyclohexene ring, which is a six-membered carbon ring containing one double bond, and two methyl groups attached to the 3rd and 5th carbon atoms of the ring. This compound is known for its distinctive ketone functional group at the 1-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the double bond and the ketone group makes it a candidate for various chemical reactions, including electrophilic additions and cycloadditions. Its molecular structure imparts certain physical properties, such as volatility and solubility in organic solvents. 3,5-Dimethyl-2-cyclohexen-1-one may also exhibit interesting aromatic characteristics due to its structural features, making it relevant in the study of flavor and fragrance chemistry. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C8H12O
InChI:InChI=1/C8H12O/c1-6-3-7(2)5-8(9)4-6/h4,7H,3,5H2,1-2H3/t7-/m1/s1
InChI key:InChIKey=NOQKKFBBAODEHN-UHFFFAOYSA-N
SMILES:CC1CC(C)=CC(=O)C1
Synonyms:- (5R)-3,5-dimethylcyclohex-2-en-1-one
- (5S)-3,5-dimethylcyclohex-2-en-1-one
- 2-Cyclohexen-1-one, 3,5-dimethyl-
- 3,5-Dimethylcyclohex-2-en-1-one
- Ai3-21772
- NSC 10113
- NSC 845
- 3,5-Dimethyl-2-cyclohexen-1-one
- 3,5-diMethylcyclohex-2-enone
- 3,5-Dimethyl-2-cyclohexene-1-one
- 3,5-Dimethyl-2-cyclohexen-1-one,99%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dimethyl-2-cyclohexen-1-one
CAS:Formula:C8H12OPurity:95%Color and Shape:LiquidMolecular weight:124.18033,5-Dimethyl-2-Cyclohexen-1-One
CAS:3,5-Dimethyl-2-Cyclohexen-1-OnePurity:95%Molecular weight:124.18g/mol3,5-Dimethyl-2-cyclohexen-1-one
CAS:3,5-Dimethyl-2-cyclohexen-1-one is a β-unsaturated ketone that has been synthesized using an efficient method. It has been shown to have anti-inflammatory properties and is used for the treatment of pulmonary fibrosis in humans. The compound also binds to polyene compounds and supramolecular substrates. 3,5-Dimethyl-2-cyclohexen-1-one reacts with chloride ions to form a β unsaturated ketone chloride that can undergo alkylation with an electron donor such as acetonitrile. This reaction is catalyzed by microsomal cytochrome P450 enzymes and requires a reaction time of about two hours to complete.
Formula:C8H12OPurity:Min. 95%Molecular weight:124.18 g/mol



