CAS 1123-10-0

Methylthiouracil

Description:

Methylthiouracil is an organic compound classified as a thiouracil derivative, primarily known for its role as an antithyroid agent. It features a methyl group and a thiol group attached to a uracil ring, which contributes to its biological activity. The compound is typically used in the treatment of hyperthyroidism, as it inhibits the synthesis of thyroid hormones by blocking the enzyme thyroperoxidase, thereby reducing the incorporation of iodine into thyroglobulin. Methylthiouracil is a white to off-white crystalline solid that is soluble in water and exhibits a moderate melting point. Its chemical structure allows it to interact with various biological systems, making it significant in pharmacology. Additionally, it may have side effects, including potential impacts on liver function and blood cell counts, necessitating careful monitoring during treatment. As with many pharmaceuticals, its use should be guided by a healthcare professional, considering the balance between therapeutic benefits and potential risks.

Formula: C₅H₆N₂OS

InChI: InChI=1S/C5H6N2OS/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9)

InChI key: InChIKey=HWGBHCRJGXAGEU-UHFFFAOYSA-N

SMILES: CC1=CC(=O)NC(=S)N1

Synonyms:

• 4(1H)-Pyrimidinone, 2,3-dihydro-6-methyl-2-thioxo-
• Antibason
• 2,3-Dihydro-6-methyl-2-thioxo-4(1H)-pyrimidinone
• Uracil, 6-methyl-2-thio-
• Alkiron