CAS 1123-24-6
:1-methylcyclohexanecarboxamide
Description:
1-Methylcyclohexanecarboxamide, with the CAS number 1123-24-6, is an organic compound characterized by its amide functional group attached to a cyclohexane ring that has a methyl substituent. This compound features a cyclohexane backbone, which contributes to its cyclic structure and influences its physical properties, such as boiling and melting points. The presence of the carboxamide group (-C(=O)NH2) imparts polar characteristics, enhancing its solubility in polar solvents like water and alcohols. The methyl group adds to the steric bulk and can affect the compound's reactivity and interaction with other molecules. Typically, amides exhibit moderate to high boiling points due to hydrogen bonding capabilities. 1-Methylcyclohexanecarboxamide may be utilized in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c1-8(7(9)10)5-3-2-4-6-8/h2-6H2,1H3,(H2,9,10)
SMILES:CC1(CCCCC1)C(=N)O
Synonyms:- Cyclohexanecarboxamide, 1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Methylcyclohexane-1-carboxamide
CAS:<p>1-Methylcyclohexane-1-carboxamide is a sclerotiorin, which are natural substances that have been shown to have inhibitory effects against fungi. It has been shown to be effective against Sclerotinia sclerotiorum and Gaseous Botrytis cinerea. The inhibition of sclerotiorin 1-methylcyclohexane-1-carboxamide is due to its ability to inhibit the synthesis of ergosterol, which is an important component of the fungal cell membrane. This drug has also been shown to have inhibitory effects on carbon bond formation in natural substances such as ginseng root or solid form.</p>Formula:C8H15NOPurity:Min. 95%Molecular weight:141.21 g/mol
