CAS 1123-28-0

1-HYDROXY-CYCLOHEXANECARBOXYLIC ACID

Description:

1-Hydroxy-cyclohexanecarboxylic acid, with the CAS number 1123-28-0, is an organic compound characterized by a cyclohexane ring substituted with both a hydroxyl group (-OH) and a carboxylic acid group (-COOH). This compound typically appears as a colorless to pale yellow solid or liquid, depending on its purity and form. It is soluble in water and polar organic solvents due to the presence of the hydroxyl and carboxylic acid functional groups, which can engage in hydrogen bonding. The presence of these functional groups also imparts acidic properties to the compound, allowing it to participate in various chemical reactions, such as esterification and neutralization. Additionally, 1-hydroxy-cyclohexanecarboxylic acid may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features contribute to its potential applications in organic synthesis and as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₁₂O₃

InChI: InChI=1/C7H12O3/c8-6(9)7(10)4-2-1-3-5-7/h10H,1-5H2,(H,8,9)

SMILES: C1CCC(CC1)(C(=O)O)O

Synonyms:

• 1-Hydroxy-cyclohexanecarboxylicacid

1-Hydroxy-cyclohexanecarboxylic acid

CAS: 1123-28-0

Formula: C₇H₁₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 144.17

Ref: 10-F056520

1-Hydroxycyclohexanecarboxylic acid

CAS: 1123-28-0

Formula: C₇H₁₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 144.1684

Ref: IN-DA007TM8

1-Hydroxy-cyclohexanecarboxylic acid

CAS: 1123-28-0

1-Hydroxy-cyclohexanecarboxylic acid

Purity: 98%

Molecular weight: 144.17g/mol

Ref: 54-OR951583