CymitQuimica logo

CAS 1123-30-4

:

8-Azaspiro[4.5]decane, hydrochloride (1:1)

Description:
8-Azaspiro[4.5]decane, hydrochloride (1:1), with the CAS number 1123-30-4, is a bicyclic organic compound characterized by its spiro structure, which consists of a nitrogen atom incorporated into a bicyclic framework. This compound features a unique arrangement of carbon and nitrogen atoms, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The presence of the azaspiro moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its structural characteristics may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Additionally, the hydrochloride form can affect the compound's stability and shelf life. Overall, 8-Azaspiro[4.5]decane, hydrochloride is notable for its unique structural features and potential applications in drug development, although specific biological activities and therapeutic uses would require further investigation.
Formula:C9H17N·ClH
InChI:InChI=1S/C9H17N.ClH/c1-2-4-9(3-1)5-7-10-8-6-9;/h10H,1-8H2;1H
InChI key:InChIKey=DRTLAKIFUNGWIM-UHFFFAOYSA-N
SMILES:C12(CCNCC1)CCCC2.Cl
Synonyms:
  • 8-Azaspiro[4.5]decane, hydrochloride
  • 8-Azaspiro[4.5]decane,hydrochloride (7CI,8CI,9CI)
  • 8-Azaspiro[4.5]decane, hydrochloride (1:1)
Found 4 products.