CymitQuimica logo

CAS 1123-48-4

:

1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone

Description:
1-(3,5-Dimethyl-1H-pyrazol-4-yl)ethanone, with the CAS number 1123-48-4, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to a pyrazole ring that has two methyl groups at the 3 and 5 positions. The presence of these substituents influences its reactivity and solubility, making it a polar molecule. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities. Its synthesis often involves the reaction of appropriate pyrazole derivatives with acetylating agents. As with many organic compounds, handling should be done with care, considering safety data sheets for toxicity and environmental impact. Overall, 1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone serves as a valuable building block in organic synthesis and research applications.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-4-7(6(3)10)5(2)9-8-4/h1-3H3,(H,8,9)
InChI key:XVFAWYIDDRHPNV-UHFFFAOYSA-N
SMILES:Cc1c(c(C)n[nH]1)C(=O)C
Synonyms:
  • ethanone, 1-(3,5-dimethyl-1H-pyrazol-4-yl)-
Found 4 products.