CAS 1123-51-9

4-Benzothiazolamine

Description:

4-Benzothiazolamine, with the CAS number 1123-51-9, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the amino group (-NH2) in its structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, 4-benzothiazolamine may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper safety protocols should be followed when working with this compound in laboratory settings.

Formula: C₇H₆N₂S

InChI: InChI=1/C7H6N2S/c8-5-2-1-3-6-7(5)9-4-10-6/h1-4H,8H2

SMILES: c1cc(c2c(c1)scn2)N

Synonyms:

• 1,3-Benzothiazol-4-Amine
• Benzothiazol-4-ylamine

4-Benzothiazolamine (9CI)

CAS: 1123-51-9

Formula: C₇H₆N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 150.2009

Ref: IN-DA008V7R

4-Aminobenzothiazole

CAS: 1123-51-9

4-Aminobenzothiazole

Formula: C₇H₆N₂S

Purity: Tech (Typical Value in Batch COA)

Color and Shape: brown solid

Molecular weight: 150.20g/mol

Ref: 54-OR346148

Benzothiazol-4-ylamine

CAS: 1123-51-9

Formula: C₇H₆N₂S

Purity: 95%

Color and Shape: Brown solid

Molecular weight: 150.2

Ref: 10-F047384

Benzo[d]thiazol-4-amine

Controlled Product

CAS: 1123-51-9

Applications BENZO[D]THIAZOL-4-AMINE (cas# 1123-51-9) is a useful research chemical.

Formula: C₇H₆N₂S

Color and Shape: Neat

Molecular weight: 150.2

Ref: TR-B130530