
CAS 1123-66-6
:1,2,4,6-Tetramethylpiperazine
Description:
1,2,4,6-Tetramethylpiperazine is a cyclic organic compound characterized by its piperazine structure, which features a six-membered ring containing two nitrogen atoms. The compound is distinguished by the presence of four methyl groups attached to the piperazine ring at the 1, 2, 4, and 6 positions, contributing to its unique chemical properties. It is a colorless to pale yellow liquid with a distinctive amine-like odor. This substance is soluble in water and organic solvents, making it versatile for various applications. 1,2,4,6-Tetramethylpiperazine is often utilized as a building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its basicity is notable, as the nitrogen atoms can act as proton acceptors, which influences its reactivity and interactions with other chemical species. Additionally, it may exhibit properties such as low volatility and moderate toxicity, necessitating appropriate handling precautions in laboratory and industrial settings.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-7-5-9(3)6-8(2)10(7)4/h7-8H,5-6H2,1-4H3
InChI key:InChIKey=XVJRVYONDJGSLX-UHFFFAOYSA-N
SMILES:CN1C(C)CN(C)CC1C
Synonyms:- Piperazine, 1,2,4,6-tetramethyl-
- 1,2,4,6-Tetramethylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.