CAS 1123-92-8
:5-Chloro-2,1,3-benzoselenadiazole
Description:
5-Chloro-2,1,3-benzoselenadiazole is an organic compound characterized by its unique structure, which includes a selenadiazole ring fused to a benzene ring, along with a chlorine substituent at the 5-position. This compound typically exhibits a pale yellow to light brown appearance and is known for its heterocyclic nature, which contributes to its chemical reactivity and potential applications in various fields, including materials science and pharmaceuticals. The presence of selenium in the selenadiazole moiety imparts distinctive electronic properties, making it of interest in the development of semiconductors and as a building block in organic synthesis. Additionally, the chlorine atom enhances its reactivity, allowing for further functionalization. The compound is generally stable under standard conditions but may undergo reactions typical of halogenated heterocycles, such as nucleophilic substitution. Safety data indicates that, like many organochlorine compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-Chloro-2,1,3-benzoselenadiazole is a valuable compound in research and industrial applications.
Formula:C6H3ClN2Se
InChI:InChI=1S/C6H3ClN2Se/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H
InChI key:InChIKey=CTMDEMMDWLZMIP-UHFFFAOYSA-N
SMILES:ClC1=CC=2C(C=C1)=N[Se]N2
Synonyms:- 2,1,3-Benzoselenadiazole, 5-Chloro-
- 5-Chloropiazselenol
- 5-Chloropiazselenole
- NSC 49767
- 5-Chloro-2,1,3-benzoselenadiazole
- 5-Chloro-2,1,3-benzoselenadiazole
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery