CAS 1123169-07-2
:3-(3-Pyrrolidinyloxy)benzenamine
Description:
3-(3-Pyrrolidinyloxy)benzenamine, identified by its CAS number 1123169-07-2, is an organic compound characterized by the presence of a pyrrolidine ring and an amino group attached to a benzene ring. This compound features a pyrrolidinyloxy substituent, which contributes to its potential biological activity. The molecular structure suggests that it may exhibit properties such as being a potential ligand for various receptors, possibly influencing neurotransmitter systems. The presence of both the amino and ether functionalities indicates that it may engage in hydrogen bonding, affecting its solubility and reactivity. Additionally, the compound's aromatic nature may impart stability and influence its interaction with other chemical species. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this type are often investigated for their pharmacological potential, particularly in the fields of medicinal chemistry and drug development. Further studies would be necessary to elucidate its complete profile, including its synthesis, reactivity, and biological effects.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c11-8-2-1-3-9(6-8)13-10-4-5-12-7-10/h1-3,6,10,12H,4-5,7,11H2
InChI key:InChIKey=MSSAFEKOQVIRFC-UHFFFAOYSA-N
SMILES:O(C1=CC(N)=CC=C1)C2CCNC2
Synonyms:- Benzenamine, 3-(3-pyrrolidinyloxy)-
- 3-(3-Pyrrolidinyloxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
