
CAS 1123169-14-1
:Methyl 5-methoxy-1,2-benzisothiazole-3-carboxylate
Description:
Methyl 5-methoxy-1,2-benzisothiazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a benzisothiazole moiety and a methoxy group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylate group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its methoxy substituent can influence its reactivity and polarity, potentially enhancing its solubility in polar solvents. Compounds of this type are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. Additionally, the benzisothiazole framework is known for its applications in the development of dyes, agrochemicals, and pharmaceuticals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, Methyl 5-methoxy-1,2-benzisothiazole-3-carboxylate represents a class of compounds with diverse applications in chemical research and industry.
Formula:C10H9NO3S
InChI:InChI=1S/C10H9NO3S/c1-13-6-3-4-8-7(5-6)9(11-15-8)10(12)14-2/h3-5H,1-2H3
InChI key:InChIKey=KNUAAKYINZNFGJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(SN1)=CC=C(OC)C2
Synonyms:- Methyl 5-methoxy-1,2-benzisothiazole-3-carboxylate
- 1,2-Benzisothiazole-3-carboxylic acid, 5-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.