
CAS 1123169-16-3
:Methyl 5-methoxy-1,2-benzisoxazole-3-carboxylate
Description:
Methyl 5-methoxy-1,2-benzisoxazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a benzisoxazole ring system and a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the carboxylate functional group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Methyl 5-methoxy-1,2-benzisoxazole-3-carboxylate may also display solubility in organic solvents, making it useful in synthetic applications. Its molecular structure allows for potential interactions with biological targets, which has led to interest in its pharmacological properties. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and material science, although specific biological activities and applications would require further investigation.
Formula:C10H9NO4
InChI:InChI=1S/C10H9NO4/c1-13-6-3-4-8-7(5-6)9(11-15-8)10(12)14-2/h3-5H,1-2H3
InChI key:InChIKey=UXTZSMRXNWXVMO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(ON1)=CC=C(OC)C2
Synonyms:- 1,2-Benzisoxazole-3-carboxylic acid, 5-methoxy-, methyl ester
- Methyl 5-methoxy-1,2-benzisoxazole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
