CAS 1123169-18-5

Ethyl 2-(acetylamino)-4-bromobenzeneacetate

Description:

Ethyl 2-(acetylamino)-4-bromobenzeneacetate is an organic compound characterized by its complex structure, which includes an ethyl ester group, an acetylamino functional group, and a bromobenzene moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. The acetylamino group contributes to its potential biological activity, possibly influencing its interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₁₂H₁₄BrNO₃

InChI: InChI=1S/C12H14BrNO3/c1-3-17-12(16)6-9-4-5-10(13)7-11(9)14-8(2)15/h4-5,7H,3,6H2,1-2H3,(H,14,15)

InChI key: InChIKey=WFQICSIAQMOEGF-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1=C(NC(C)=O)C=C(Br)C=C1

Synonyms:

• Ethyl 2-(acetylamino)-4-bromobenzeneacetate
• Benzeneacetic acid, 2-(acetylamino)-4-bromo-, ethyl ester