CymitQuimica logo

CAS 1123169-35-6

:

1-Ethyl-2,3-dihydro-1H-indole-6-carboxaldehyde

Description:
1-Ethyl-2,3-dihydro-1H-indole-6-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features an ethyl group at the nitrogen position and a carboxaldehyde functional group at the 6-position of the indole ring. The presence of the carboxaldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The dihydro form suggests that the compound has two additional hydrogen atoms compared to its fully aromatic counterpart, which may influence its reactivity and stability. This compound may exhibit properties typical of indole derivatives, including potential biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various synthetic modifications, which can lead to the exploration of its potential applications in pharmaceuticals and other fields.
Formula:C11H13NO
InChI:InChI=1S/C11H13NO/c1-2-12-6-5-10-4-3-9(8-13)7-11(10)12/h3-4,7-8H,2,5-6H2,1H3
InChI key:InChIKey=USEHYEPYWMJVAG-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(CC1)=CC=C(C=O)C2
Synonyms:
  • 1-Ethyl-2,3-dihydro-1H-indole-6-carboxaldehyde
  • 1H-Indole-6-carboxaldehyde, 1-ethyl-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.