
CAS 1123169-38-9
:1-Ethyl-2,3-dihydro-1H-indole-6-methanamine
Description:
1-Ethyl-2,3-dihydro-1H-indole-6-methanamine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features an ethyl group at the nitrogen position and a methanamine substituent, which contributes to its unique reactivity and potential biological activity. The presence of the dihydroindole moiety suggests that it may exhibit properties typical of both indoles and amines, potentially influencing its solubility, stability, and interaction with biological targets. The compound's molecular structure may allow for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 1123169-38-9, serves as a unique identifier for regulatory and research purposes. As with many organic compounds, its characteristics, including melting point, boiling point, and reactivity, would depend on the specific conditions under which it is studied. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-2-13-6-5-10-4-3-9(8-12)7-11(10)13/h3-4,7H,2,5-6,8,12H2,1H3
InChI key:InChIKey=GEVYOSNSUVHYKK-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(CC1)=CC=C(CN)C2
Synonyms:- 1-Ethyl-2,3-dihydro-1H-indole-6-methanamine
- 1H-Indole-6-methanamine, 1-ethyl-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
