CymitQuimica logo

CAS 1123169-51-6

:

3-(2-Pyrimidinyl)-1,2,4-oxadiazole-5-methanamine

Description:
3-(2-Pyrimidinyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for heterocyclic compounds. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their roles in medicinal chemistry, often exhibiting antimicrobial, anti-inflammatory, or anticancer properties. The methanamine group can enhance the compound's reactivity and may influence its interaction with biological targets. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. Overall, 3-(2-Pyrimidinyl)-1,2,4-oxadiazole-5-methanamine is of interest in research for its potential applications in pharmaceuticals and materials science, although specific biological activity and applications would require further investigation.
Formula:C7H7N5O
InChI:InChI=1S/C7H7N5O/c8-4-5-11-7(12-13-5)6-9-2-1-3-10-6/h1-3H,4,8H2
InChI key:InChIKey=XIHCCFHPOUDIPQ-UHFFFAOYSA-N
SMILES:C(N)C1=NC(=NO1)C=2N=CC=CN2
Synonyms:
  • 1,2,4-Oxadiazole-5-methanamine, 3-(2-pyrimidinyl)-
  • 3-(2-Pyrimidinyl)-1,2,4-oxadiazole-5-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.