CymitQuimica logo

CAS 1123169-52-7

:

6-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-2-naphthalenecarboxylic acid

Description:
6-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-2-naphthalenecarboxylic acid is a chemical compound characterized by its complex structure, which includes a naphthalene ring system, a chloro substituent, and an amide functional group. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group, which can influence its reactivity and solubility. This compound is likely to exhibit properties typical of both carboxylic acids and amines, such as the ability to form salts and participate in various chemical reactions, including nucleophilic substitutions and acylations. Its tetrahydro configuration suggests it may have specific stereochemical properties that could affect its biological activity. The chloro substituent may also impart unique reactivity, making it a potential candidate for further chemical modifications. Overall, this compound's characteristics make it of interest in medicinal chemistry and synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C16H20ClNO4
InChI:InChI=1S/C16H20ClNO4/c1-15(2,3)22-14(21)18-16(13(19)20)7-6-10-8-12(17)5-4-11(10)9-16/h4-5,8H,6-7,9H2,1-3H3,(H,18,21)(H,19,20)
InChI key:InChIKey=LZJLTCQUVKSYKI-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(C(O)=O)CC=2C(CC1)=CC(Cl)=CC2
Synonyms:
  • 2-Naphthalenecarboxylic acid, 6-chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-
  • 6-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-2-naphthalenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.