CAS 1123169-54-9
:7-(Phenylmethoxy)-1H-indazole-3-carbonitrile
Description:
7-(Phenylmethoxy)-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a phenylmethoxy group enhances its lipophilicity and may influence its biological activity. The carbonitrile functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 7-(Phenylmethoxy)-1H-indazole-3-carbonitrile represents a class of compounds that may have significant implications in various fields, including pharmaceuticals and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H11N3O
InChI:InChI=1S/C15H11N3O/c16-9-13-12-7-4-8-14(15(12)18-17-13)19-10-11-5-2-1-3-6-11/h1-8H,10H2,(H,17,18)
InChI key:InChIKey=AJFNJMAKEYSEAW-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(C(C#N)=NN3)=CC=C2
Synonyms:- 7-(Phenylmethoxy)-1H-indazole-3-carbonitrile
- 1H-Indazole-3-carbonitrile, 7-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
