CAS 112342-72-0

6-Bromo[1,3]thiazolo[4,5-b]pyrazin-2-amine

Description:

6-Bromo[1,3]thiazolo[4,5-b]pyrazin-2-amine is a heterocyclic compound characterized by the presence of both thiazole and pyrazine rings, which contribute to its unique chemical properties. The bromine substituent at the 6-position enhances its reactivity and can influence its biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine functional group that can participate in hydrogen bonding and other interactions. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 6-Bromo[1,3]thiazolo[4,5-b]pyrazin-2-amine represents a valuable scaffold for further research in drug discovery and development.

Formula: C₅H₃BrN₄S

InChI: InChI=1/C5H3BrN4S/c6-2-1-8-3-4(9-2)11-5(7)10-3/h1H,(H2,7,8,10)

SMILES: c1c(Br)nc2c([nH]1)nc(=N)s2

Synonyms:

• Thiazolo[4,5-B]Pyrazin-2-Amine, 6-Bromo-

6-Bromothiazolo[4,5-b]pyrazin-2-amine

CAS: 112342-72-0

Formula: C₅H₃BrN₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.0731

Ref: IN-DA007BFB

6-Bromothiazolo[4,5-b]pyrazin-2-amine

CAS: 112342-72-0

6-Bromothiazolo[4,5-b]pyrazin-2-amine

Purity: 97%

Molecular weight: 231.08g/mol

Ref: 54-OR75066

2-Amino-6-bromothiazolo[4,5-b]pyrazine

CAS: 112342-72-0

Formula: C₅H₃BrN₄S

Purity: 98%

Molecular weight: 231.07

Ref: 10-F076123

2-Amino-6-bromothiazolo[4,5-b]pyrazine

Controlled Product

CAS: 112342-72-0

Formula: C₅H₃BrN₄S

Color and Shape: Neat

Molecular weight: 231.073

Ref: TR-A595130