CAS 112348-46-6

L-Proline, 2-(2-propen-1-yl)-, methyl ester, hydrochloride (1:1)

Description:

L-Proline, 2-(2-propen-1-yl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a proline backbone modified with a propenyl group and a methyl ester functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. L-Proline is an amino acid that plays a crucial role in protein synthesis and is known for its involvement in collagen formation. The presence of the propenyl group may impart unique reactivity, making it useful in organic synthesis and potentially in medicinal chemistry. The hydrochloride form indicates that the compound is protonated, which can influence its biological activity and interaction with other molecules. Overall, this compound may be of interest in research related to pharmaceuticals, biochemistry, and materials science due to its structural features and potential applications.

Formula: C₉H₁₅NO₂·ClH

InChI: InChI=1S/C9H15NO2.ClH/c1-3-5-9(8(11)12-2)6-4-7-10-9;/h3,10H,1,4-7H2,2H3;1H/t9-;/m0./s1

InChI key: InChIKey=XRMINVQYJGVCCV-FVGYRXGTSA-N

SMILES: C(OC)(=O)[C@]1(CC=C)CCCN1.Cl

Synonyms:

• L-Proline, 2-(2-propen-1-yl)-, methyl ester, hydrochloride (1:1)
• L-Proline, 2-(2-propenyl)-, methyl ester, hydrochloride