CAS 112368-54-4

4-fluorophenacyl bromide

Description:

4-Fluorophenacyl bromide is an organic compound characterized by its structure, which includes a phenacyl group substituted with a fluorine atom at the para position of the aromatic ring. This compound typically appears as a solid and is known for its reactivity, particularly in electrophilic substitution reactions due to the presence of the bromine atom, which can act as a leaving group. The fluorine substituent can influence the electronic properties of the molecule, potentially enhancing its reactivity in certain chemical environments. 4-Fluorophenacyl bromide is often utilized in organic synthesis, particularly in the preparation of various derivatives and in the development of photochemical applications. Its properties make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity. Proper storage and handling protocols are essential to ensure safety in laboratory settings.

Formula: C₈H₆Br¹⁸FO

InChI: InChI=1/C8H6BrFO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2/i10-1

SMILES: c1cc(ccc1C(=O)CBr)[18F]

Synonyms:

• (18F) 4-Fluorophenacyl bromide
• 2-Bromo-1-(4-(fluoro-18F)phenyl)ethanone
• Ethanone, 2-bromo-1-(4-(fluoro-18F)phenyl)-
• 2-Bromo-1-(4-Fluorophenyl)Ethanone
• 2-bromo-1-[4-(~18~F)fluorophenyl]ethanone