CAS 112372-06-2
:Furo[2,3-c]pyridine-2-carboxaldehyde
Description:
Furo[2,3-c]pyridine-2-carboxaldehyde is a heterocyclic organic compound characterized by its fused furan and pyridine rings, along with an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. The presence of the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. Furo[2,3-c]pyridine derivatives are of interest in medicinal chemistry due to their biological activities, which may include antimicrobial and anticancer properties. The compound's structure allows for potential interactions with biological targets, making it a subject of research in drug development. Additionally, its unique aromatic system may contribute to its stability and reactivity under different conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C8H5NO2
InChI:InChI=1S/C8H5NO2/c10-5-7-3-6-1-2-9-4-8(6)11-7/h1-5H
InChI key:InChIKey=KKUIVASBGOEYGD-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=2C(O1)=CN=CC2
Synonyms:- Furo[2,3-c]pyridine-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
