CAS 112372-08-4

Furo[3,2-b]pyridine-2-carboxaldehyde, oxime

Description:

Furo[3,2-b]pyridine-2-carboxaldehyde, oxime, is a chemical compound characterized by its unique structure that combines a furo[3,2-b]pyridine moiety with an oxime functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the carboxaldehyde group suggests that it can participate in various chemical reactions, such as condensation and oxidation, while the oxime functionality may allow for further derivatization or coordination with metal ions. Furo[3,2-b]pyridine derivatives are often studied for their biological activities, including potential applications in pharmaceuticals. The compound's solubility and polarity can vary based on the substituents present, influencing its behavior in different solvents. Additionally, its spectral properties, such as UV-Vis and NMR, can provide insights into its electronic structure and molecular interactions. Overall, Furo[3,2-b]pyridine-2-carboxaldehyde, oxime, represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c11-10-5-6-4-7-8(12-6)2-1-3-9-7/h1-5,11H

InChI key: InChIKey=FSDXVYOPEIDOCZ-UHFFFAOYSA-N

SMILES: C(=NO)C1=CC=2C(O1)=CC=CN2

Synonyms:

• Furo[3,2-b]pyridine-2-carboxaldehyde, oxime