CymitQuimica logo

CAS 112372-12-0

:

Furo[2,3-c]pyridine-2-carbonitrile

Description:
Furo[2,3-c]pyridine-2-carbonitrile is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyridine and a furan moiety. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the furan ring imparts unique electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. Furo[2,3-c]pyridine derivatives are of interest in pharmaceutical research due to their biological activity, which may include antimicrobial and anticancer properties. The compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications. Additionally, its molecular structure allows for potential interactions with biological targets, making it a subject of study in drug design. Overall, Furo[2,3-c]pyridine-2-carbonitrile represents a versatile scaffold in organic chemistry with implications in both synthetic and medicinal fields.
Formula:C8H4N2O
InChI:InChI=1S/C8H4N2O/c9-4-7-3-6-1-2-10-5-8(6)11-7/h1-3,5H
InChI key:InChIKey=MFIZNCADACKZAC-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=2C(O1)=CN=CC2
Synonyms:
  • Furo[2,3-c]pyridine-2-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.