CAS 112372-14-2
:Furo[3,2-b]pyridine-2-carboxylic acid
Description:
Furo[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused furan and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, making it acidic and capable of participating in various chemical reactions, such as esterification and amidation. The presence of both the furan and pyridine moieties enhances its potential for biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with biological targets, which may lead to applications in drug development. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its reactivity and utility in synthetic chemistry. As with many heterocycles, Furo[3,2-b]pyridine-2-carboxylic acid may exhibit interesting electronic properties due to the conjugation between the aromatic systems, which can be exploited in materials science and organic electronics. Overall, this compound represents a versatile scaffold for further chemical exploration and application.
Formula:C8H5NO3
InChI:InChI=1S/C8H5NO3/c10-8(11)7-4-5-6(12-7)2-1-3-9-5/h1-4H,(H,10,11)
InChI key:InChIKey=VHRCHODSRLMXFM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(O1)=CC=CN2
Synonyms:- Furo[3,2-b]pyridine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Furo[3,2-b]pyridine-2-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H5NO3Purity:97%Color and Shape:Powder, CreamMolecular weight:163.13Furo[3,2-b]pyridine-2-carboxylic acid
CAS:<p>Furo[3,2-b]pyridine-2-carboxylic acid is a borohydride diester with the molecular formula CHB(OCH)CHB(OH)COOH. It is created by the decarboxylation of furopyridine (a compound of the class of furopyridines), followed by hydrolysis and cyclization. It can be synthesized by reacting ethyl bromoacetate with phosphoric acid and then hydrolyzed to yield a hydroxy derivative. Furo[3,2-b]pyridine-2-carboxylic acid is used in organic chemistry as an intermediate for other compounds, such as pharmaceuticals and pesticides.</p>Formula:C8H5NO3Purity:Min. 95%Molecular weight:163.13 g/mol


