CAS 112372-20-0

3-Hydroxy-2-pyridineacetonitrile

Description:

3-Hydroxy-2-pyridineacetonitrile, with the CAS number 112372-20-0, is an organic compound characterized by its pyridine ring and a hydroxyl group attached to the carbon adjacent to the nitrile functional group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar solvents due to the presence of the hydroxyl group. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, as the pyridine moiety is often found in biologically active compounds. The presence of the nitrile group may also impart unique reactivity, making it useful in various synthetic pathways. Additionally, the compound may exhibit specific physical properties such as melting and boiling points that are influenced by intermolecular interactions, including hydrogen bonding. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-Hydroxy-2-pyridineacetonitrile is a compound of interest in organic chemistry and related fields.

Formula: C₇H₆N₂O

InChI: InChI=1S/C7H6N2O/c8-4-3-6-7(10)2-1-5-9-6/h1-2,5,10H,3H2

InChI key: InChIKey=KXCLEESYGWKEHV-UHFFFAOYSA-N

SMILES: C(C#N)C1=C(O)C=CC=N1

Synonyms:

• 2-Pyridineacetonitrile, 3-hydroxy-
• 2-(3-Hydroxypyridin-2-yl)acetonitrile
• 3-Hydroxy-2-pyridineacetonitrile