
CAS 112372-23-3
:Furo[2,3-c]pyridine-3-carboxamide
Description:
Furo[2,3-c]pyridine-3-carboxamide is a heterocyclic organic compound characterized by its fused furan and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxamide functional group, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of nitrogen in the pyridine ring imparts basicity and can influence its reactivity in various chemical reactions. Furo[2,3-c]pyridine-3-carboxamide is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with fused heterocycles. Additionally, the compound's properties can be further explored in fields such as agrochemicals and materials science. As with many organic compounds, its behavior in different environments, including its reactivity and interaction with biological systems, can vary significantly based on specific conditions and substituents.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c9-8(11)6-4-12-7-3-10-2-1-5(6)7/h1-4H,(H2,9,11)
InChI key:InChIKey=QEJHHARLMLJLLK-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=2C(OC1)=CN=CC2
Synonyms:- Furo[2,3-c]pyridine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.