CAS 112375-42-5
:methyl (6Z)-8-methylnon-6-enoate
Description:
Methyl (6Z)-8-methylnon-6-enoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a long carbon chain, specifically a nonene structure, indicating the presence of a double bond in the carbon chain at the sixth position, with a specific geometric configuration (Z) that influences its physical and chemical properties. The presence of the methyl group at the eighth position contributes to its branched structure, which can affect its reactivity and interactions with other molecules. Methyl (6Z)-8-methylnon-6-enoate is likely to be a colorless to pale yellow liquid with a characteristic odor, typical of esters. It may exhibit moderate solubility in organic solvents and limited solubility in water. This compound can be utilized in various applications, including as a flavoring agent, fragrance, or in synthetic organic chemistry for the production of more complex molecules. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C11H20O2
InChI:InChI=1/C11H20O2/c1-10(2)8-6-4-5-7-9-11(12)13-3/h6,8,10H,4-5,7,9H2,1-3H3/b8-6-
SMILES:CC(C)/C=C\CCCCC(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(6Z)-8-Methyl-6-nonenoic Acid Methyl Ester-d3
CAS:Controlled ProductFormula:C11D3H17O2Color and Shape:NeatMolecular weight:187.294(6Z)-8-Methyl-6-nonenoic Acid Methyl Ester
CAS:Controlled ProductFormula:C11H20O2Color and Shape:NeatMolecular weight:184.275
