
CAS 1123837-99-9
:6-Bromo-N-(2-methoxyethyl)-3-pyridinemethanamine
Description:
6-Bromo-N-(2-methoxyethyl)-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The N-(2-methoxyethyl) group indicates that there is an ether functional group attached to the nitrogen atom, which can enhance solubility and potentially affect the compound's pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, and the bromine substituent may also play a role in modulating these interactions. Overall, the characteristics of this compound make it a subject of interest for further research in the fields of organic chemistry and pharmacology.
Formula:C9H13BrN2O
InChI:InChI=1S/C9H13BrN2O/c1-13-5-4-11-6-8-2-3-9(10)12-7-8/h2-3,7,11H,4-6H2,1H3
InChI key:InChIKey=CVGDUJKDLGUWEI-UHFFFAOYSA-N
SMILES:C(NCCOC)C=1C=CC(Br)=NC1
Synonyms:- 6-Bromo-N-(2-methoxyethyl)-3-pyridinemethanamine
- N-[(6-Bromopyridin-3-yl)methyl]-2-methoxyethanamine
- 3-Pyridinemethanamine, 6-bromo-N-(2-methoxyethyl)-
- [(6-Bromopyridin-3-yl)methyl](2-methoxyethyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.