CymitQuimica logo

CAS 1124-07-8

:

2,4-Dichloro-5-methylphenol

Description:
2,4-Dichloro-5-methylphenol, with the CAS number 1124-07-8, is an organic compound that belongs to the class of chlorinated phenols. It is characterized by the presence of two chlorine atoms and a methyl group attached to a phenolic ring. This compound typically appears as a solid or crystalline substance and is known for its antimicrobial properties, making it useful in various applications, including as a preservative and disinfectant. It is soluble in organic solvents but has limited solubility in water. The compound exhibits a distinct odor and can be hazardous, necessitating careful handling due to its potential toxicity and environmental impact. Its chemical structure contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, 2,4-Dichloro-5-methylphenol is subject to regulations due to its potential effects on human health and the environment, emphasizing the importance of safety measures during its use and disposal.
Formula:C7H6Cl2O
InChI:InChI=1S/C7H6Cl2O/c1-4-2-7(10)6(9)3-5(4)8/h2-3,10H,1H3
InChI key:InChIKey=NDCNJVOXMCCKBP-UHFFFAOYSA-N
SMILES:CC1=C(Cl)C=C(Cl)C(O)=C1
Synonyms:
  • 2,4-Dichloro-5-methylphenol
  • Nsc 60723
  • Phenol, 2,4-dichloro-5-methyl-
  • m-Cresol, 4,6-dichloro-
  • m-Cresol, 4,6-dichloro- (8CI)
  • 4,6-Dichloro-m-cresol
Found 4 products.