CAS 1124-08-9

1,4-Diiodo-2,5-dimethylbenzene

Description:

1,4-Diiodo-2,5-dimethylbenzene, also known as p-diiodo-o-xylene, is an organic compound characterized by the presence of two iodine atoms and two methyl groups attached to a benzene ring. Its molecular structure features a symmetrical arrangement with iodine substituents at the para positions (1 and 4) and methyl groups at the ortho positions (2 and 5). This compound is typically a solid at room temperature and exhibits a relatively high molecular weight due to the presence of heavy iodine atoms. It is insoluble in water but may dissolve in organic solvents. The presence of iodine atoms imparts notable reactivity, making it useful in various chemical syntheses, particularly in the field of organic chemistry for the preparation of iodinated compounds. Additionally, the methyl groups contribute to the compound's hydrophobic characteristics and influence its physical properties, such as melting and boiling points. Safety precautions should be taken when handling this compound, as iodine can be hazardous, and proper storage conditions are necessary to maintain its stability.

Formula: C₈H₈I₂

InChI: InChI=1/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3

SMILES: Cc1cc(c(C)cc1I)I

Synonyms:

• 2,5-Diiodo-p-xylene

1,4-Diiodo-2,5-dimethylbenzene

CAS: 1124-08-9

Formula: C₈H₈I₂

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 357.96

Ref: 3B-D5589

Benzene,1,4-diiodo-2,5-dimethyl-

CAS: 1124-08-9

Formula: C₈H₈I₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 357.9581

Ref: IN-DA0082NJ

1,4-Diiodo-2,5-dimethylbenzene

CAS: 1124-08-9

1,4-Diiodo-2,5-dimethylbenzene

Formula: C₈H₈I₂

Purity: 98%

Color and Shape: white crystals

Molecular weight: 357.96g/mol

Ref: 54-OR0399

1,4-DIIODO-2,5-DIMETHYLBENZENE

CAS: 1124-08-9

Formula: C₈H₈I₂

Purity: 97%

Molecular weight: 357.961

Ref: 10-F533412

1,4-Diiodo-2,5-dimethylbenzene

CAS: 1124-08-9

1,4-Diiodo-2,5-dimethylbenzene is an iodide that can be used in the industrialization of iodine. It can be prepared from bicyclopropylidene and nitrosobenzene by coupling with a carbonyl group. The yield of this reaction is high and the product is stable. 1,4-Diiodo-2,5-dimethylbenzene can also be prepared by palladium-catalyzed cross coupling or a Diels–Alder reaction between 2,5-dimethylaniline and 3-(bromomethyl)cyclobutane. This process yields only one regioisomer because there are no other reactive groups on the ring to form a second regioisomeric product.

Formula: C₈H₈I₂

Purity: Min. 95%

Molecular weight: 357.96 g/mol

Ref: 3D-BAA12408