CAS 1124-18-1
:toluene-alpha,alpha,alpha-D3
Description:
Toluene-alpha,alpha,alpha-D3, also known as deuterated toluene, is a chemical compound that is a deuterated form of toluene, where three hydrogen atoms in the methyl group are replaced by deuterium isotopes. Its molecular formula is C7D8, and it retains the aromatic characteristics of toluene, featuring a benzene ring bonded to a methyl group. This compound is primarily used in research and analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuteration enhances the resolution and sensitivity of the spectra. Toluene-alpha,alpha,alpha-D3 is a colorless liquid with a characteristic sweet odor, similar to that of regular toluene. It is less volatile than its non-deuterated counterpart due to the presence of heavier deuterium atoms. The compound is generally stable under standard conditions but should be handled with care, as toluene and its derivatives can be harmful if inhaled or ingested. Its unique isotopic composition allows for various applications in studying reaction mechanisms and molecular dynamics in organic chemistry.
Formula:C7H5D3
InChI:InChI=1/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i1D3
SMILES:C(c1ccccc1)([2H])([2H])[2H]
Synonyms:- Benzene, methyl-d3-
- Toluene-d3
- (~2~H_3_)methylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Toluene-α,α,α-d3
CAS:Formula:C6H5CD3Purity:99 atom % DColor and Shape:Colorless LiquidMolecular weight:95.08143Trideuteriomethylbenzene
CAS:Controlled ProductTrideuteriomethylbenzene is a chemical compound that contains three deuterium atoms. It is a member of the class of compounds called alkyl-deuteriomethylbenzenes, which are used as proton donors in chemical reactions. It has been shown to be an effective supercritical solvent for the separation of long-chain alcohols from hydrocarbons. Trideuteriomethylbenzene may also be used as a photoelectron donor for the determination of time constants and depression constants by electron diffraction.
Formula:C7H5D3Purity:Min. 95%Molecular weight:95.16 g/mol




