CAS 1124-64-7: 1-Butylpyridinium chloride
Description:1-Butylpyridinium chloride is an ionic liquid characterized by its unique combination of a pyridinium cation and a butyl group, paired with a chloride anion. This compound typically appears as a colorless to yellowish liquid at room temperature, exhibiting low volatility, which makes it an attractive alternative to traditional organic solvents. It has a relatively high thermal stability, allowing it to be used in various chemical processes without significant degradation. The presence of the butyl group contributes to its hydrophobic nature, while the pyridinium ring provides some degree of polarity, facilitating solubility in both polar and nonpolar solvents. 1-Butylpyridinium chloride is known for its ability to dissolve a wide range of organic and inorganic compounds, making it useful in applications such as extraction, catalysis, and electrochemistry. Additionally, its ionic nature imparts unique properties, such as enhanced ionic conductivity, which is beneficial in electrochemical applications. Overall, this compound is a versatile and valuable substance in both research and industrial settings.
Formula:C9H14N·Cl
InChI:InChI=1S/C9H14N.ClH/c1-2-3-7-10-8-5-4-6-9-10;/h4-6,8-9H,2-3,7H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=POKOASTYJWUQJG-UHFFFAOYSA-M
SMILES:[Cl-].C=1C=C[N+](=CC1)CCCC
- Synonyms:
- 1-Butylpyridinium
- Butylpyridinium chloride
- N-(n-Butyl)pyridinium chloride
- N-1-Butylpyridinium chloride
- N-butylpyridinium chloride
- Pyridinium, 1-butyl-, chloride
- Pyridinium, 1-butyl-, chloride (1:1)
- 1-Butylpyridinium chloride
