CymitQuimica logo

CAS 1124213-11-1

:

1-(Azidomethyl)cyclopropanecarbonitrile

Description:
1-(Azidomethyl)cyclopropanecarbonitrile is a chemical compound characterized by its unique structural features, including a cyclopropane ring and an azide functional group. The presence of the azide group (-N3) imparts notable reactivity, making it a potential candidate for various synthetic applications, particularly in click chemistry and as a precursor for further functionalization. The carbonitrile group (-C≡N) contributes to the compound's polarity and can influence its solubility in organic solvents. This compound is typically handled with caution due to the inherent instability and potential explosiveness of azides under certain conditions. Its molecular structure suggests that it may exhibit interesting physical properties, such as boiling and melting points, which are influenced by the steric and electronic effects of the cyclopropane and functional groups. Overall, 1-(Azidomethyl)cyclopropanecarbonitrile is of interest in organic synthesis and materials science, particularly for developing novel compounds with specific reactivity profiles.
Formula:C5H6N4
InChI:InChI=1S/C5H6N4/c6-3-5(1-2-5)4-8-9-7/h1-2,4H2
InChI key:InChIKey=IBHXYBCANROUPG-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1(C#N)CC1
Synonyms:
  • 1-(Azidomethyl)cyclopropanecarbonitrile
  • 1-(Azidomethyl)cyclopropane-1-carbonitrile
  • Cyclopropanecarbonitrile, 1-(azidomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.