CAS 112455-84-2
:Papuamine
Description:
Papuamine, with the CAS number 112455-84-2, is a naturally occurring alkaloid primarily derived from the plant species found in the Papuan region. It is characterized by its complex molecular structure, which includes a bicyclic framework. Papuamine exhibits notable biological activity, particularly in its potential as an antimicrobial and cytotoxic agent, making it of interest in pharmaceutical research. The compound has been studied for its effects on various cell lines, indicating its potential utility in cancer treatment. Additionally, Papuamine's solubility properties and stability under different pH conditions are relevant for its application in drug formulation. Its synthesis and extraction methods are also significant, as they influence the yield and purity of the compound. Overall, Papuamine represents a fascinating subject of study within the field of natural products chemistry, with implications for medicinal chemistry and drug development.
Formula:C25H40N2
InChI:InChI=1S/C25H40N2/c1-3-10-20-18(8-1)16-24-22(20)12-5-6-13-23-21-11-4-2-9-19(21)17-25(23)27-15-7-14-26-24/h5-6,12-13,18-27H,1-4,7-11,14-17H2/b12-5+,13-6+/t18-,19-,20+,21+,22-,23-,24+,25+/m0/s1
InChI key:InChIKey=ZKTFUNZCYRUILZ-XVMYYXKMSA-N
SMILES:[C@@]1/2([C@]3([C@](C[C@]1(NCCCN[C@]4([C@@](\C=C\C=C2)([C@]5([C@](C4)(CCCC5)[H])[H])[H])[H])[H])(CCCC3)[H])[H])[H]
Synonyms:- (-)-Papuamine
- (4aS,5aR,10aR,11aS,15aR,15bS,16E,18E,19aS,19bR)-2,3,4,4a,5,5a,6,7,8,9,10,10a,11,11a,12,13,14,15,15a,15b,19a,19b-Docosahydro-1H-diindeno[2,1-f:1′,2′-l][1,5]diazacyclotridecine
- 112455-84-2
- 1H-Diindeno[2,1-f:1′,2′-l][1,5]diazacyclotridecine, 2,3,4,4a,5,5a,6,7,8,9,10,10a,11,11a,12,13,14,15,15a,15b,19a,19b-docosahydro-, (4aS,5aR,10aR,11aS,15aR,15bS,16E,18E,19aS,19bR)-
- 1H-Diindeno[2,1-f:1′,2′-l][1,5]diazacyclotridecine, 2,3,4,4a,5,5a,6,7,8,9,10,10a,11,11a,12,13,14,15,15a,15b,19a,19b-docosahydro-, [4aS-(4aR*,5aS*,10aS*,11aR*,15aS*,15bR*,16E,18E,19aR*,19bS*)]-
- [4aS-(4aR*,5aS*,10aS*,11aR*,15aS*,15bR*,16E,18E,19aR*,19bS*)]-2,3,4,4a,5,5a,6,7,8,9,10,10a,11,11a,12,13,14,15,15a,15b,19a,19b-Docosahydro-1H-diindeno[2,1-f:1',2'-1][1,5]diazacyclotridecine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
