CymitQuimica logo

CAS 1125-01-5

:

3-Azaspiro[5.5]undecane, hydrochloride (1:1)

Description:
3-Azaspiro[5.5]undecane, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. This compound is a hydrochloride salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in water and other polar solvents. The presence of the azaspiro moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, although specific biological activities can vary. Its molecular structure allows for various stereochemical configurations, which can influence its reactivity and interactions with biological systems. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other non-covalent interactions, which are crucial for its function in biological contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H20ClN
InChI:InChI=1/C10H19N.ClH/c1-2-4-10(5-3-1)6-8-11-9-7-10;/h11H,1-9H2;1H
InChI key:InChIKey=XDRWSBJRLMRJKA-UHFFFAOYSA-N
SMILES:C12(CCCCC1)CCNCC2.Cl
Synonyms:
  • 3-Azaspiro(5.5)undecane HCl
  • 3-Azaspiro[5.5]Undecane Hydrochloride (1:1)
  • 3-Azaspiro[5.5]undecane, hydrochloride
  • 9-azaspiro[5.5]undecane chloride
  • 4,4-Pentamethylenepiperidine
Found 5 products.