CAS 1125-02-6
:N-(1-Cyanocyclohexyl)formamide
Description:
N-(1-Cyanocyclohexyl)formamide, with the CAS number 1125-02-6, is an organic compound characterized by its functional groups, including a formamide moiety and a cyanocyclohexyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate polarity due to the presence of both the amide and nitrile groups, which can influence its solubility in various organic solvents. The compound may exhibit moderate to high stability under standard conditions but can be sensitive to hydrolysis, particularly in the presence of strong acids or bases. Its chemical reactivity is largely dictated by the functional groups, allowing for potential participation in nucleophilic addition reactions. N-(1-Cyanocyclohexyl)formamide may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c9-6-8(10-7-11)4-2-1-3-5-8/h7H,1-5H2,(H,10,11)
InChI key:InChIKey=URXDVBRMOBTTLS-UHFFFAOYSA-N
SMILES:N(C=O)C1(C#N)CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.