CAS 1125-29-7
:1,3,5-TRIMETHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID
Description:
1,3,5-Trimethyl-1H-pyrazole-4-carboxylic acid, with the CAS number 1125-29-7, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features three methyl groups attached to the pyrazole ring and a carboxylic acid functional group at the 4-position, contributing to its acidic properties. It is typically a white to off-white crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its structure allows for various chemical modifications, making it a versatile building block in synthetic chemistry. Additionally, it may exhibit specific reactivity patterns typical of pyrazole derivatives, such as coordination with metal ions or participation in condensation reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-4-6(7(10)11)5(2)9(3)8-4/h1-3H3,(H,10,11)
SMILES:Cc1c(c(C)n(C)n1)C(=O)O
Synonyms:- Art-Chem-Bb B006363
- Akos B006363
- Akos Pao-0337
- Rarechem Al Be 0403
- 1,3,5-Trimethyl-1H-pyrazole-4-carboxylic acid, 95+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1H-Pyrazole-4-carboxylic acid, 1,3,5-trimethyl-
CAS:Formula:C7H10N2O2Purity:98%Color and Shape:SolidMolecular weight:154.16651,3,5-Trimethyl-1H-Pyrazole-4-Carboxylic Acid
CAS:1,3,5-Trimethyl-1H-Pyrazole-4-Carboxylic AcidPurity:≥98%Molecular weight:154.17g/mol1,3,5-Trimethyl-1H-Pyrazole-4-Carboxylic Acid
CAS:1,3,5-Trimethyl-1H-Pyrazole-4-Carboxylic Acid (1,3,5-trimethylpyrazole-4-carboxylic acid) is a marine derived natural products found in Cinachyrella sp.Formula:C7H10N2O2Purity:99.75%Color and Shape:SolidMolecular weight:154.171,3,5-Trimethyl-1H-pyrazole-4-carboxylic acid
CAS:1,3,5-Trimethyl-1H-pyrazole-4-carboxylic acidFormula:C7H10N2O2Purity:≥95%Color and Shape: white solidMolecular weight:154.17g/mol1,3,5-Trimethyl-1H-pyrazole-4-carboxylic Acid
CAS:Controlled ProductApplications 1,3,5-trimethyl-1H-pyrazole-4-carboxylic acid (cas# 1125-29-7) is a useful research chemical.
Formula:C7H10N2O2Color and Shape:NeatMolecular weight:154.1671,3,5-Trimethyl-1H-pyrazole-4-carboxylic acid
CAS:Formula:C7H10N2O2Purity:95%Color and Shape:SolidMolecular weight:154.169





