CAS 1125-66-2
:4-CHLORO-3-ETHYL-5-METHYLPHENOL
Description:
4-Chloro-3-ethyl-5-methylphenol, with the CAS number 1125-66-2, is an organic compound that belongs to the class of phenols. It features a phenolic ring substituted with a chlorine atom, an ethyl group, and a methyl group, which contributes to its unique chemical properties. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of its alkyl substituents. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses and applications. Additionally, 4-chloro-3-ethyl-5-methylphenol may exhibit antimicrobial properties, which can be advantageous in industrial applications, particularly in the formulation of disinfectants and preservatives. Safety considerations should be taken into account, as with many chlorinated compounds, due to potential toxicity and environmental impact. Proper handling and disposal methods are essential to mitigate any risks associated with its use.
Formula:C9H11ClO
InChI:InChI=1/C9H11ClO/c1-3-7-5-8(11)4-6(2)9(7)10/h4-5,11H,3H2,1-2H3
SMILES:CCc1cc(cc(C)c1Cl)O
Synonyms:- Phenol, 4-chloro-3-ethyl-5-methyl-
- 4-Chloro-3-ethyl-5-methylphenol
- 3-ethyl-4-chloro-5-methyl-phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.