
CAS 1125-67-3
:3-Methoxy-5-methyl-1,2-benzenediol
Description:
3-Methoxy-5-methyl-1,2-benzenediol, also known as orcinol, is an organic compound characterized by its aromatic structure featuring a methoxy group and a methyl group attached to a benzene ring that also contains two hydroxyl groups. This compound is typically a white to pale yellow crystalline solid with a sweet, pleasant odor. It is soluble in alcohol and ether but has limited solubility in water. The presence of hydroxyl groups contributes to its ability to participate in hydrogen bonding, influencing its reactivity and solubility. 3-Methoxy-5-methyl-1,2-benzenediol is often used in the synthesis of various organic compounds and can serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical products. Additionally, it exhibits antioxidant properties, making it of interest in various biochemical applications. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-5-3-6(9)8(10)7(4-5)11-2/h3-4,9-10H,1-2H3
InChI key:InChIKey=FALWUVSXNUUXQA-UHFFFAOYSA-N
SMILES:O(C)C1=C(O)C(O)=CC(C)=C1
Synonyms:- 3-Methoxy-5-methylcatechol
- 1,2-Benzenediol, 3-methoxy-5-methyl-
- 3-Methoxy-5-methyl-1,2-benzenediol
- Pyrocatechol, 3-methoxy-5-methyl-
- 3-Methoxy-5-methylpyrocatechol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.