CAS 1125-89-9

6-Hydroxyskatole

Description:

6-Hydroxyskatole, with the CAS number 1125-89-9, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by the presence of a hydroxyl group (-OH) attached to the skatole structure, which is derived from indole. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents. 6-Hydroxyskatole is known for its potential biological activities, including antimicrobial and antioxidant properties, making it of interest in various fields such as pharmaceuticals and biochemistry. Its molecular structure allows for interactions with biological systems, which can influence metabolic pathways. Additionally, it may play a role in the synthesis of other chemical compounds or serve as an intermediate in organic synthesis. As with many chemical substances, handling 6-Hydroxyskatole requires appropriate safety precautions due to its potential reactivity and biological effects.

Formula: C₉H₉NO

InChI: InChI=1S/C9H9NO/c1-6-5-10-9-4-7(11)2-3-8(6)9/h2-5,10-11H,1H3

InChI key: InChIKey=AXSWRCGZBWBXQD-UHFFFAOYSA-N

SMILES: CC=1C=2C(NC1)=CC(O)=CC2

Synonyms:

• Indol-6-ol, 3-methyl-
• 6-Hydroxyskatole
• 3-Methyl-1H-indol-6-ol
• 6-Hydroxyskatol
• 1H-Indol-6-ol, 3-methyl-

3-methyl-1H-indol-6-ol

CAS: 1125-89-9

Formula: C₉H₉NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.1739

Ref: IN-DA0091OX

3-METHYL-1H-INDOL-6-OL

CAS: 1125-89-9

Formula: C₉H₉NO

Purity: 97%

Molecular weight: 147.177

Ref: 10-F502215

3-Methyl-1H-indol-6-ol

CAS: 1125-89-9

3-Methyl-1H-indol-6-ol is a metabolite of estrone sulfate, which is produced by the activity of cytochrome P450 enzymes. It has been shown to be an effective inhibitor of chemical reactions in urine samples and primary cells. 3-Methyl-1H-indol-6-ol also has a role in the metabolism of estrogens and may play a part in the development of symptoms such as those seen in human liver disease or testicular cancer. 3-Methylindole can be found as an endogenous metabolite in schizophrenic patients and is known to inhibit constitutive androstane receptor (CAR) activity, which regulates gene expression and cellular growth.

Formula: C₉H₉NO

Purity: Min. 95%

Molecular weight: 147.18 g/mol

Ref: 3D-BAA12589