CymitQuimica logo

CAS 1125-90-2

:

N-[(2-METHOXYPHENYL)METHYLENE]-N-METHYLAMINE

Description:
N-[(2-Methoxyphenyl)methylene]-N-methylamine, with the CAS number 1125-90-2, is an organic compound characterized by its amine functional group and a methylene bridge connecting a methoxy-substituted phenyl group to a methylamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the methoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with other molecules. Additionally, the structure suggests potential reactivity, particularly in electrophilic aromatic substitution reactions due to the electron-donating nature of the methoxy group. This compound may be of interest in medicinal chemistry and organic synthesis, where its unique structural features could be leveraged for the development of pharmaceuticals or other functional materials. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c1-10-7-8-5-3-4-6-9(8)11-2/h3-7H,1-2H3/b10-7+
Synonyms:
  • Methanamine, N-((2-methoxyphenyl)methylene)-
  • N-[(E)-(2-methoxyphenyl)methylidene]methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.