CAS 112501-42-5
:Piperolactam A
Description:
Piperolactam A is a chemical compound characterized by its unique structure, which includes a lactam ring derived from piperidine. It is known for its potential biological activities, particularly in the realm of medicinal chemistry. The compound exhibits properties that may influence various physiological processes, making it a subject of interest for research in drug development. Piperolactam A is typically synthesized through specific organic reactions that involve the manipulation of piperidine derivatives. Its molecular structure contributes to its solubility and reactivity, which are important factors in its application in biological systems. Additionally, Piperolactam A may interact with various biological targets, leading to effects that are being explored in pharmacological studies. As with many compounds, understanding its stability, reactivity, and interaction with other substances is crucial for its potential use in therapeutic contexts. Overall, Piperolactam A represents a fascinating area of study within organic and medicinal chemistry, with ongoing research aimed at elucidating its full range of properties and applications.
Formula:C16H11NO3
InChI:InChI=1S/C16H11NO3/c1-20-12-7-10-13-11(17-16(10)19)6-8-4-2-3-5-9(8)14(13)15(12)18/h2-7,18H,1H3,(H,17,19)
InChI key:InChIKey=KBGNBPGXVKPRQI-UHFFFAOYSA-N
SMILES:OC=1C2=C3C(=CC=4C2=CC=CC4)NC(=O)C3=CC1OC
Synonyms:- 1-Hydroxy-2-methoxydibenz[cd,f]indol-4(5H)-one
- Aristolactam FI
- Aristololactam FI
- Piperolactam A
- dibenz[cd,f]indol-4(5H)-one, 1-hydroxy-2-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Aristolactam FI
CAS:Aristolactam FI shows platelet aggregation inhibitory activity.It is a potential cancer chemotherapeutic and chemopreventive agent.Formula:C16H11NO3Purity:98%Color and Shape:SolidMolecular weight:265.26Aristolactam FI
CAS:Formula:C16H11NO3Purity:95%~99%Color and Shape:Yellow powderMolecular weight:265.268Aristolactam F1
CAS:<p>Aristolactam F1 is an alkaloidal compound, which is a naturally occurring organic molecule derived from certain plants, particularly within the Aristolochiaceae family. It is biosynthesized through complex biochemical pathways that involve the transformation of primary plant metabolites. The mode of action of Aristolactam F1 involves intercalation between DNA base pairs, which can disrupt DNA processes such as replication and transcription. This mechanism is of particular interest due to its potential impact on cellular proliferation and gene expression.</p>Formula:C16H11NO3Purity:Min. 95%Molecular weight:265.26 g/mol



