CAS 112515-43-2
:Topsentin
Description:
Topsentin, with the CAS number 112515-43-2, is a chemical compound that belongs to the class of natural products known as alkaloids. It is primarily derived from marine organisms, particularly certain species of sponges. Topsentin exhibits a complex molecular structure characterized by multiple rings and functional groups, which contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Research has indicated that Topsentin may interact with various biological targets, influencing cellular processes. Its unique structure and bioactivity make it a subject of ongoing studies aimed at understanding its mechanisms of action and potential therapeutic applications. However, detailed information regarding its toxicity, environmental impact, and specific applications in medicine may still be under investigation, highlighting the need for further research to fully elucidate its characteristics and utility in various fields.
Formula:C20H14N4O2
InChI:InChI=1S/C20H14N4O2/c25-11-5-6-13-15(9-22-17(13)7-11)19(26)20-23-10-18(24-20)14-8-21-16-4-2-1-3-12(14)16/h1-10,21-22,25H,(H,23,24)
InChI key:InChIKey=TVPNFKRGOFJQOO-UHFFFAOYSA-N
SMILES:C(=O)(C=1NC(C=2C=3C(NC2)=CC=CC3)=CN1)C=4C=5C(NC4)=CC(O)=CC5
Synonyms:- Topsentine B 1
- Methanone, (6-hydroxy-1H-indol-3-yl)[5-(1H-indol-3-yl)-1H-imidazol-2-yl]-
- Methanone, (6-hydroxy-1H-indol-3-yl)[4-(1H-indol-3-yl)-1H-imidazol-2-yl]-
- Topsentine B 1
- Topsentin B 1
- Topsentin
- (6-hydroxy-1H-indol-3-yl)[5-(1H-indol-3-yl)-1H-imidazol-2-yl]methanone
- Methanone, (6-hydroxy-1H-indol-3-yl)(4-(1H-indol-3-yl)-1H-imidazol-2-yl)-
- (6-Hydroxy-1H-indol-3-yl)[5-(1H-indol-3-yl)-1H-imidazol-2-yl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
