CAS 112516-04-8
:Tubuloside B
Description:
Tubuloside B, with the CAS number 112516-04-8, is a natural compound classified as a glycoside, specifically derived from the plant species Tubulicrinis. It is known for its unique structural features, which include a sugar moiety attached to a non-sugar component, contributing to its biological activity. Tubuloside B exhibits various pharmacological properties, including potential anti-inflammatory and cytotoxic effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action may involve modulation of cellular pathways, although specific details may vary based on the context of its use. The compound's solubility, stability, and reactivity can be influenced by its glycosidic structure, which may affect its bioavailability and therapeutic efficacy. Research into Tubuloside B continues to explore its potential applications in drug development and its role in traditional medicine. As with many natural products, the extraction and purification processes are critical for obtaining this compound in a form suitable for further study and application.
Formula:C31H38O16
InChI:InChI=1S/C31H38O16/c1-14-24(38)26(40)27(41)30(44-14)47-28-25(39)22(13-43-23(37)8-5-16-3-6-18(33)20(35)11-16)46-31(29(28)45-15(2)32)42-10-9-17-4-7-19(34)21(36)12-17/h3-8,11-12,14,22,24-31,33-36,38-41H,9-10,13H2,1-2H3/b8-5+/t14-,22+,24-,25+,26+,27+,28-,29+,30-,31+/m0/s1
InChI key:InChIKey=HFJIGXAMJFDVFR-OMRKUVHCSA-N
SMILES:O([C@@H]1[C@@H](OC(C)=O)[C@H](OCCC2=CC(O)=C(O)C=C2)O[C@H](COC(/C=C/C3=CC(O)=C(O)C=C3)=O)[C@H]1O)[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:- Tubuloside B
- b-D-Glucopyranoside,2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-a-L-mannopyranosyl)-, 2-acetate6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-, 2-acetate 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-, 2-acetate 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 2-acetate 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 2-acetate 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
tubuloside B
CAS:<p>Tubuloside B from Cistanche salsa stems guards SH-SY5Y cells against TNFalpha-induced apoptosis.</p>Formula:C31H38O16Purity:97.59% - 99.72%Color and Shape:SolidMolecular weight:666.62Tubuloside B
CAS:<p>Tubuloside B is a bioactive glycoside, which is an active compound isolated from certain medicinal herbs, particularly in the Oleaceae family. It functions primarily through its antioxidant and anti-inflammatory properties, acting by scavenging free radicals and influencing various biochemical pathways involved in cell protection and immune response regulation.</p>Formula:C31H38O16Purity:Min. 95%Molecular weight:666.6 g/molβ-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 2-acetate 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
CAS:Formula:C31H38O16Purity:95%Molecular weight:666.6238





