CAS 1125409-83-7

1-[4-(Dimethylamino)phenyl]-1H-benzimidazole-5-carboxylic acid

Description:

1-[4-(Dimethylamino)phenyl]-1H-benzimidazole-5-carboxylic acid, identified by its CAS number 1125409-83-7, is a chemical compound that features a benzimidazole core substituted with a dimethylamino group and a carboxylic acid functional group. This compound typically exhibits characteristics such as moderate solubility in polar solvents due to the presence of the carboxylic acid, which can engage in hydrogen bonding. The dimethylamino group contributes to its basicity and potential for forming salts. The benzimidazole moiety is known for its biological activity, often being involved in pharmaceutical applications, particularly in the development of drugs targeting various diseases. The compound may also exhibit fluorescence properties, making it useful in certain analytical applications. Its structural features suggest potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, this compound represents a class of organic molecules with diverse applications in research and industry, particularly in the fields of pharmaceuticals and biochemistry.

Formula: C₁₆H₁₅N₃O₂

InChI: InChI=1S/C16H15N3O2/c1-18(2)12-4-6-13(7-5-12)19-10-17-14-9-11(16(20)21)3-8-15(14)19/h3-10H,1-2H3,(H,20,21)

InChI key: InChIKey=BZBXIBLSKIGCGB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(N(C=N2)C3=CC=C(N(C)C)C=C3)=CC1

Synonyms:

• 1H-Benzimidazole-5-carboxylic acid, 1-[4-(dimethylamino)phenyl]-
• 1-[4-(Dimethylamino)phenyl]-1H-benzimidazole-5-carboxylic acid