CymitQuimica logo

CAS 1125409-86-0

:

N-(3-Chloro-4-methoxyphenyl)guanidine

Description:
N-(3-Chloro-4-methoxyphenyl)guanidine is a chemical compound characterized by its guanidine functional group, which is known for its basicity and ability to form hydrogen bonds. The presence of a chloro group and a methoxy group on the phenyl ring contributes to its unique reactivity and solubility properties. This compound typically exhibits moderate to high polarity due to the electronegative chlorine and oxygen atoms, which can influence its interactions in biological systems. It may also display potential biological activity, making it of interest in pharmaceutical research. The molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Additionally, its stability and reactivity can be affected by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks. Overall, N-(3-Chloro-4-methoxyphenyl)guanidine represents a compound with diverse chemical characteristics suitable for further investigation in various scientific fields.
Formula:C8H10ClN3O
InChI:InChI=1S/C8H10ClN3O/c1-13-7-3-2-5(4-6(7)9)12-8(10)11/h2-4H,1H3,(H4,10,11,12)
InChI key:InChIKey=JGOPTUOKOZUFBJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(Cl)C=C(NC(=N)N)C=C1
Synonyms:
  • N-(3-Chloro-4-methoxyphenyl)guanidine
  • Guanidine, N-(3-chloro-4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.