CAS 1125410-09-4

3-Iodo-2,5-pyridinediamine

Description:

3-Iodo-2,5-pyridinediamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two amino groups (-NH2) at the 2 and 5 positions of the pyridine ring contributes to its basicity and potential reactivity, making it a versatile intermediate in organic synthesis. The iodine substituent at the 3 position enhances its electrophilic character, allowing for further chemical modifications. This compound may exhibit solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Additionally, 3-Iodo-2,5-pyridinediamine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in materials science. Its reactivity and functional groups make it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many nitrogen-containing compounds, it is essential to handle it with care, considering potential toxicity and environmental impact.

Formula: C₅H₆IN₃

InChI: InChI=1S/C5H6IN3/c6-4-1-3(7)2-9-5(4)8/h1-2H,7H2,(H2,8,9)

InChI key: InChIKey=SECWUDQFVZPDOS-UHFFFAOYSA-N

SMILES: IC1=C(N)N=CC(N)=C1

Synonyms:

• 3-Iodo-2,5-pyridinediamine
• 2,5-Pyridinediamine, 3-iodo-
• 2,5-Diamino-3-iodopyridine