CAS 112543-66-5
:3-deoxy-D-glycero-D-galacto-2-*nonulosonic acid A
Description:
3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid A, commonly referred to as Kdn, is a nonulosonic acid that plays a significant role in the structure of glycoproteins and glycolipids, particularly in the context of bacterial and viral interactions. This compound is characterized by its unique nine-carbon backbone, which includes a ketone functional group, contributing to its classification as a nonulosonic acid. Kdn is an important component of sialic acids, which are often found on the surface of cells and are involved in various biological processes, including cell signaling and immune response. The presence of hydroxyl groups in its structure allows for various chemical modifications, enhancing its biological activity. Kdn is also known for its role in the modulation of cellular interactions and has implications in microbiology and immunology. Its CAS number, 112543-66-5, is used for identification in chemical databases, facilitating research and application in biochemical studies. Overall, Kdn is a significant molecule in the field of glycobiology, with potential applications in therapeutics and vaccine development.
Formula:C9H16O9
InChI:InChI=1/C9H16O9/c10-2-4(12)6(14)7-5(13)3(11)1-9(17,18-7)8(15)16/h3-7,10-14,17H,1-2H2,(H,15,16)/t3?,4-,5?,6-,7?,9?/m1/s1
SMILES:C1C(C(C([C@@H]([C@@H](CO)O)O)OC1(C(=O)O)O)O)O
Synonyms:- 3-Deoxy-D-Glycero-D-Galacto-2-Nonulosonic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.